destiniesdavis214 destiniesdavis214

21-09-2020
Mathematics

contestada

f(x) = -4x + 9 and g(x) = 2x - 7,
find f ( g (x))

Respuesta :

melvinbarnes50 melvinbarnes50

21-09-2020

F=5 if I’m not mistaking

Answer Link

Otras preguntas

Patricia is a business owner who is trying to determine the cost of goods sold for 2019. She bought 20 units of inventory at $11, then 26 units at $9, and final

Can someone answer this for me. My teacher gave me this As a Hint so once I get this I’m good plz help To find the decay factor, b, find the ratio of the consec

URGENT It is given that a regular n-sided polygon has 5 sides more than aregular m-sided polygon. If the sum of interior angles of the regularn-sided polygon is

In a Little League baseball game, the 145 g ball reaches the batter with a speed of 15.0 m/s. The batter hits the ball, and it leaves his bat with a speed of 20

Excerpt 2: Not wishing to be considered as a prophet of evil omen, Jane kept her own counsel in regard to this significant discovery. But later, after the child

two firms, A and B, each currently emit 100 tons of chemicals into the air. THe government has decided to reuce the pollution and from now on will require

is everything that we can see in the universe matter

John has 9 boxes of apples. Each box holds 16 apples. If 7 boxes are full, and 2 of the boxes are half full, how many apples does john have?

Give the IUPAC name of the given compound.(CH3)-CH(NH2)-CH3

The Fourteenth Amendment established all of the following EXCEPT: equal protection under the law. the abolition of slavery. the extension of due p